CAS 1053656-92-0

2-[(4-Bromophenyl)methyl]-4-thiazoleacetic acid

Description:

2-[(4-Bromophenyl)methyl]-4-thiazoleacetic acid is a chemical compound characterized by its thiazole and aromatic bromophenyl moieties. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its potential biological activity. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific structure and substituents. Its acidic functional group, the acetic acid moiety, suggests potential reactivity in various chemical reactions, including esterification and amidation. The compound may also possess pharmacological properties, making it of interest in medicinal chemistry. As with many thiazole derivatives, it could be investigated for applications in drug development, particularly in areas such as anti-inflammatory or antimicrobial therapies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₂H₁₀BrNO₂S

InChI: InChI=1S/C12H10BrNO2S/c13-9-3-1-8(2-4-9)5-11-14-10(7-17-11)6-12(15)16/h1-4,7H,5-6H2,(H,15,16)

InChI key: InChIKey=LMJCAGYWYSQRTQ-UHFFFAOYSA-N

SMILES: C(C1=NC(CC(O)=O)=CS1)C2=CC=C(Br)C=C2

Synonyms:

• 4-Thiazoleacetic acid, 2-[(4-bromophenyl)methyl]-
• 2-[(4-Bromophenyl)methyl]-4-thiazoleacetic acid

2-(4-Bromobenzyl)thiazole-4-acetic acid

CAS: 1053656-92-0

Formula: C₁₂H₁₀BrNO₂S

Molecular weight: 312.1823

Ref: IN-DA00HAN6

[2-(4-Bromobenzyl)thiazol-4-y]acetic acid

CAS: 1053656-92-0

[2-(4-Bromobenzyl)thiazol-4-y]acetic acid

Purity: 95%

Molecular weight: 312.18g/mol

Ref: 54-OR346079