CAS 1053656-96-4: 1,1-Dimethylethyl 6-(1-piperazinyl)-2-pyridinecarboxylate

Description:1,1-Dimethylethyl 6-(1-piperazinyl)-2-pyridinecarboxylate, identified by its CAS number 1053656-96-4, is a chemical compound that features a pyridine ring substituted with a carboxylate group and a piperazine moiety. This compound is characterized by its relatively complex structure, which includes a tert-butyl group (1,1-dimethylethyl) that enhances its lipophilicity, potentially influencing its biological activity and solubility. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The carboxylate functional group may contribute to its reactivity and ability to form salts or complexes. Overall, this compound may exhibit properties relevant to pharmacology, including potential activity as a ligand or inhibitor, though specific biological activities would require empirical investigation. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would depend on the conditions under which it is handled.

Formula:C₁₄H₂₁N₃O₂

InChI:InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)11-5-4-6-12(16-11)17-9-7-15-8-10-17/h4-6,15H,7-10H2,1-3H3

InChI key:InChIKey=IWFGULANJYMPIT-UHFFFAOYSA-N

SMILES:O=C(OC(C)(C)C)C=1N=C(C=CC1)N2CCNCC2

Synonyms:
1,1-Dimethylethyl 6-(1-piperazinyl)-2-pyridinecarboxylate
2-Pyridinecarboxylic acid, 6-(1-piperazinyl)-, 1,1-dimethylethyl ester

Found 3 products.

Product data	Purity	Price range	Estimated delivery
tert-Butyl 6-piperazin-1-ypyridine-2-carboxylate REF: 54-OR97554CAS: 1053656-96-4	95+%	280.00 €	Tue 04 Mar 25
Tert-Butyl 6-piperazin-1-ypyridine-2-carboxylate REF: 10-F316481CAS: 1053656-96-4	95.0%	To inquire	Thu 13 Mar 25
tert-Butyl 6-piperazin-1-ypyridine-2-carboxylate REF: 3D-DSB65696CAS: 1053656-96-4	Min. 95%	- - -	Discontinued product