CAS 1053657-05-8

Methyl 5-(2-bromophenyl)-3-isoxazolecarboxylate

Description:

Methyl 5-(2-bromophenyl)-3-isoxazolecarboxylate is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a bromophenyl group, indicating the presence of a bromine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The methyl ester functional group contributes to its solubility in organic solvents and can participate in various chemical reactions, such as hydrolysis or transesterification. The presence of the isoxazole moiety suggests potential applications in medicinal chemistry, as isoxazoles are often found in pharmaceuticals and agrochemicals. Additionally, the bromine substituent may enhance the compound's lipophilicity and biological interactions. Overall, Methyl 5-(2-bromophenyl)-3-isoxazolecarboxylate exhibits unique structural features that may confer specific chemical properties and potential applications in research and industry.

Formula: C₁₁H₈BrNO₃

InChI: InChI=1S/C11H8BrNO3/c1-15-11(14)9-6-10(16-13-9)7-4-2-3-5-8(7)12/h2-6H,1H3

InChI key: InChIKey=CZIAHSKBAVGONL-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1)C2=CC(C(OC)=O)=NO2

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-(2-bromophenyl)-, methyl ester
• Methyl 5-(2-bromophenyl)-3-isoxazolecarboxylate

Methyl 5-(2-bromophenyl)-1,2-oxazole-3-carboxylate

CAS: 1053657-05-8

Methyl 5-(2-bromophenyl)-1,2-oxazole-3-carboxylate

Purity: 95%

Molecular weight: 282.09g/mol

Ref: 54-OR83668

Methyl 5-(2-bromophenyl)isoxazole-3-carboxylate

CAS: 1053657-05-8

Formula: C₁₁H₈BrNO₃

Purity: 97%

Molecular weight: 282.093

Ref: 10-F316483