CAS 1053657-19-4

1,1-Dimethylethyl 2-[1-(cyclobutylimino)-2-phenoxyethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[1-(cyclobutylimino)-2-phenoxyethyl]hydrazinecarboxylate, identified by its CAS number 1053657-19-4, is a chemical compound that features a complex structure incorporating a hydrazinecarboxylate moiety. This substance is characterized by the presence of a dimethyl group, which contributes to its steric bulk, and a cyclobutylimino group that adds to its reactivity and potential biological activity. The phenoxyethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The compound may exhibit various properties such as potential pharmacological activity, making it of interest in medicinal chemistry. Its hydrazine component suggests possible applications in the synthesis of other organic compounds or as a precursor in chemical reactions. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise characterization. As with many chemical substances, safety data and handling precautions are essential due to potential toxicity associated with hydrazine derivatives.

Formula: C₁₇H₂₅N₃O₃

InChI: InChI=1S/C17H25N3O3/c1-17(2,3)23-16(21)20-19-15(18-13-8-7-9-13)12-22-14-10-5-4-6-11-14/h4-6,10-11,13H,7-9,12H2,1-3H3,(H,18,19)(H,20,21)

InChI key: InChIKey=UODAROCIFDHUFI-UHFFFAOYSA-N

SMILES: C(=NC1CCC1)(COC2=CC=CC=C2)NNC(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl 2-[1-(cyclobutylimino)-2-phenoxyethyl]hydrazinecarboxylate
• Hydrazinecarboxylic acid, 2-[1-(cyclobutylimino)-2-phenoxyethyl]-, 1,1-dimethylethyl ester

N'-[1-Cyclobutylamino-2-phenoxyethylidene]hydrazinecarboxylic acid tert-butyl ester

CAS: 1053657-19-4

N'-[1-Cyclobutylamino-2-phenoxyethylidene]hydrazinecarboxylic acid tert-butyl ester

Purity: 95%

Molecular weight: 319.40g/mol

Ref: 54-OR346032