CAS 1053657-58-1

2-[[6-Methoxy-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid

Description:

2-[[6-Methoxy-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a methoxy group and a trifluoromethyl group, along with a thioacetic acid moiety. This compound exhibits properties typical of thioacetic acids, such as potential acidity due to the carboxylic acid functional group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The methoxy group can also affect the compound's electronic properties and steric hindrance. Additionally, the thioether linkage contributes to its reactivity and potential interactions in various chemical environments. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific characteristics, including solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other chemical species.

Formula: C₉H₈F₃NO₃S

InChI: InChI=1S/C9H8F3NO3S/c1-16-6-2-5(9(10,11)12)3-7(13-6)17-4-8(14)15/h2-3H,4H2,1H3,(H,14,15)

InChI key: InChIKey=OJSYLYGZQXEIFS-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=CC(C(F)(F)F)=CC(OC)=N1

Synonyms:

• 2-[[6-Methoxy-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid
• Acetic acid, 2-[[6-methoxy-4-(trifluoromethyl)-2-pyridinyl]thio]-

2-{[6-Methoxy-4-(trifluoromethyl)pyridin-2-yl]thio}acetic acid

CAS: 1053657-58-1

Formula: C₉H₈F₃NO₃S

Purity: 95.0%

Molecular weight: 267.22

Ref: 10-F316527