CAS 1053657-67-2
:2-[[6-[(4-Bromophenyl)thio]-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid
Description:
2-[[6-[(4-Bromophenyl)thio]-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with both a bromophenyl group and a trifluoromethyl group. The presence of sulfur atoms in the thioether linkages contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the bromophenyl and trifluoromethyl groups, which can influence its solubility and permeability in biological systems. Additionally, the carboxylic acid functional group at one end of the molecule may impart acidic properties, allowing for potential interactions with biological targets. Its specific applications may include roles in medicinal chemistry or as a research tool in studying biochemical pathways. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H9BrF3NO2S2
InChI:InChI=1S/C14H9BrF3NO2S2/c15-9-1-3-10(4-2-9)23-12-6-8(14(16,17)18)5-11(19-12)22-7-13(20)21/h1-6H,7H2,(H,20,21)
InChI key:InChIKey=PEOCTJDCAFPZKY-UHFFFAOYSA-N
SMILES:S(C1=CC(C(F)(F)F)=CC(SCC(O)=O)=N1)C2=CC=C(Br)C=C2
Synonyms:- Acetic acid, 2-[[6-[(4-bromophenyl)thio]-4-(trifluoromethyl)-2-pyridinyl]thio]-
- 2-[[6-[(4-Bromophenyl)thio]-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.