CAS 105369-89-9
:(3α,5β,7α,23R)-3,7,23-Trihydroxycholan-24-oic acid
Description:
The chemical substance known as (3α,5β,7α,23R)-3,7,23-Trihydroxycholan-24-oic acid, with the CAS number 105369-89-9, is a bile acid derivative that plays a significant role in the metabolism of lipids and the digestion of fats. This compound features a steroid backbone, characterized by a four-ring structure typical of steroid hormones and bile acids. The presence of three hydroxyl (-OH) groups at the 3, 7, and 23 positions contributes to its hydrophilic properties, enhancing its solubility in aqueous environments, which is crucial for its biological function in emulsifying dietary fats. The specific stereochemistry, indicated by the 3α, 5β, 7α, and 23R configurations, influences its interaction with biological membranes and receptors. As a bile acid, it is involved in the enterohepatic circulation and can impact cholesterol metabolism. Additionally, it may have implications in various physiological processes, including lipid absorption and metabolism, making it of interest in both biochemistry and pharmacology.
Formula:C24H40O5
InChI:InChI=1S/C24H40O5/c1-13(10-20(27)22(28)29)16-4-5-17-21-18(7-9-24(16,17)3)23(2)8-6-15(25)11-14(23)12-19(21)26/h13-21,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19-,20-,21+,23+,24-/m1/s1
InChI key:InChIKey=SLDVWYDDPPFGHK-WEZRZJDESA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](C[C@H]3O)(C[C@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H](C[C@H](C(O)=O)O)C)[H])[H]
Synonyms:- (23R)-Hydroxychenodeoxycholic acid
- (3alpha,5beta,7alpha,23R)-3,7,23-trihydroxycholan-24-oic acid
- (3α,5β,7α,23R)-3,7,23-Trihydroxycholan-24-oic acid
- Cholan-24-oic acid, 3,7,23-trihydroxy-, (3alpha,5beta,7alpha,23R)-
- Cholan-24-oic acid, 3,7,23-trihydroxy-, (3α,5β,7α,23R)-
- β-Phocaecholic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Phocaecholic Acid
CAS:Phocaecholic acid, a bile acid, has been identified in the bile of ducks (A. platyrhynchos).Formula:C24H40O5Color and Shape:SolidMolecular weight:408.57Phocaecholic acid
CAS:Controlled ProductPhocaecholic acid is a bile acid analog, which is derived from the endogenous bile acid cholic acid. It is typically sourced from marine mammals such as seals. Phocaecholic acid exhibits a distinct mode of action by facilitating enterohepatic circulation and modulating cholesterol and fat metabolism. This is achieved through interactions with specific transporters and nuclear receptors, influencing bile acid pools and lipid homeostasis.
Formula:C24H40O5Purity:Min. 95%Molecular weight:408.57 g/molRef: 3D-FP177593
Discontinued product

