CAS 10537-63-0

1-(4-VINYL-PHENYL)-ETHANONE

Description:

1-(4-Vinyl-phenyl)-ethanone, also known as 4-vinylbenzophenone, is an organic compound characterized by its structure, which includes a vinyl group attached to a phenyl ring and a ketone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly in polymerization processes, where the vinyl group can participate in radical reactions, making it useful in the production of various polymers and resins. The presence of the ketone group contributes to its potential applications in photoinitiators and UV-curable coatings. Additionally, 1-(4-vinyl-phenyl)-ethanone exhibits moderate solubility in organic solvents, while its stability can be influenced by exposure to light and heat. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon inhalation or skin contact. Overall, this compound plays a significant role in materials science and organic synthesis.

Formula: C₁₀H₁₀O

InChI: InChI=1/C10H10O/c1-3-9-4-6-10(7-5-9)8(2)11/h3-7H,1H2,2H3

SMILES: C=Cc1ccc(cc1)C(=O)C

Synonyms:

• Ethanone, 1-(4-Ethenylphenyl)-

1-(4-Vinylphenyl)ethanone

CAS: 10537-63-0

Formula: C₁₀H₁₀O

Purity: 97%

Color and Shape: Solid

Molecular weight: 146.1858

Ref: IN-DA009RG6

1-(4-Ethenylphenyl)Ethanone

CAS: 10537-63-0

1-(4-Ethenylphenyl)Ethanone

Purity: 98%,stabilized with TBC

Molecular weight: 146.19g/mol

Ref: 54-OR1008944