CAS 105370-60-3

(αS)-α-Butylbenzenemethanamine

Description:

(αS)-α-Butylbenzenemethanamine, with the CAS number 105370-60-3, is an organic compound characterized by its amine functional group and a butyl side chain attached to a benzene ring. This compound features a chiral center, which contributes to its stereochemistry, specifically the (αS) configuration. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the butyl group enhances its hydrophobic characteristics, while the amine group can engage in hydrogen bonding, influencing its solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its properties, such as boiling point, melting point, and reactivity, can vary based on the specific isomer and environmental conditions. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks. Overall, (αS)-α-Butylbenzenemethanamine is a compound of interest in both synthetic chemistry and potential applications in medicinal chemistry.

Formula: C₁₁H₁₇N

InChI: InChI=1S/C11H17N/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11H,2-3,9,12H2,1H3/t11-/m0/s1

InChI key: InChIKey=LQUVVWBTBOYJAU-NSHDSACASA-N

SMILES: [C@@H](CCCC)(N)C1=CC=CC=C1

Synonyms:

• Benzenemethanamine, α-butyl-, (S)-
• (1S)-1-Phenylpentan-1-amine
• Benzenemethanamine, α-butyl-, (αS)-
• (S)-α-Butylbenzenemethanamine
• (αS)-α-Butylbenzenemethanamine