
CAS 105377-03-5
:4-Fluoro-3-(1-piperazinyl)benzenamine
Description:
4-Fluoro-3-(1-piperazinyl)benzenamine, identified by its CAS number 105377-03-5, is an organic compound characterized by the presence of a fluorine atom and a piperazine ring attached to a benzeneamine structure. This compound features a fluorobenzene moiety, which enhances its lipophilicity and can influence its biological activity. The piperazine group contributes to its potential as a pharmacophore, often associated with various therapeutic effects, particularly in the field of medicinal chemistry. The presence of the amino group (-NH2) allows for hydrogen bonding, which can enhance solubility and reactivity. This compound may exhibit properties such as being a potential ligand for various receptors, making it of interest in drug discovery and development. Its structural characteristics suggest it could be involved in interactions with biological targets, potentially leading to applications in treating neurological or psychiatric disorders. As with many chemical substances, safety and handling precautions should be observed due to its potential biological activity.
Formula:C10H14FN3
InChI:InChI=1S/C10H14FN3/c11-9-2-1-8(12)7-10(9)14-5-3-13-4-6-14/h1-2,7,13H,3-6,12H2
InChI key:InChIKey=ONOSZJXLDVHCSW-UHFFFAOYSA-N
SMILES:FC1=C(C=C(N)C=C1)N2CCNCC2
Synonyms:- 4-Fluoro-3-(1-piperazinyl)aniline
- Benzenamine, 4-fluoro-3-(1-piperazinyl)-
- 4-Fluoro-3-(1-piperazinyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.