CAS 105379-24-6
:(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate
Description:
(Benzotriazol-1-yloxy)dipyrrolidinocarbenium hexafluorophosphate, with CAS number 105379-24-6, is a chemical compound that serves as a versatile reagent in organic synthesis, particularly in the field of medicinal chemistry. This substance is characterized by its unique dipyrrolidinocarbenium structure, which enhances its reactivity and stability in various chemical reactions. The presence of the benzotriazole moiety contributes to its ability to act as a strong electrophile, making it useful in coupling reactions and other transformations. The hexafluorophosphate anion provides excellent solubility in polar solvents, facilitating its use in diverse reaction conditions. Additionally, this compound is known for its thermal stability and can be handled under standard laboratory conditions. Its applications extend to the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, where it plays a crucial role in facilitating bond formation and functional group transformations. As with many chemical substances, proper safety measures should be observed when handling this compound due to its reactive nature.
Formula:C15H20F6N5OP
InChI:InChI=1/C15H20N5O.F6P/c1-2-8-14-13(7-1)16-17-20(14)21-15(18-9-3-4-10-18)19-11-5-6-12-19;1-7(2,3,4,5)6/h1-2,7-8H,3-6,9-12H2;/q+1;-1
Synonyms:- Hbpyu
- O-(Benzotriazol-1-Yl)-N,N,N',N'-Bis(Tetramethylene)Uronium Hexafluorophosphate
- O-Benzotriazol-1-Yl-N N N' N'-Bis(Tetra&
- O-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene
- HBPyUO-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene)uroniumhexafluorophosphate
- 1-[(1H-Benzotriazol-1-Yloxy)(Pyrrolidin-1-Yl)Methylidene]Pyrrolidinium Hexafluorophosphate
- Benzotriazolyl-Bis(Tetramethylene)Uronium Fluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1H-Benzo[d][1,2,3]triazol-1-yl)(di(pyrrolidin-1-yl)methylene)oxonium hexafluorophosphate(V)
CAS:Formula:C15H20F6N5OPPurity:95%Color and Shape:SolidMolecular weight:431.3164O-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene)uronium hexafluorophosphate
CAS:O-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene)uronium hexafluorophosphatePurity:98%Molecular weight:431.32g/molO-(Benzotriazol-1-yl)-N,N,N',N'-bis(tetramethylene)uronium Hexafluorophosphate
CAS:Formula:C15H20F6N5OPPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:431.32HBPyU
CAS:HBPyU is a coupling reagent of the uronium salts used in solid phase peptide chemistry. HBPyU is a stable, highly reactive pyrrolidino derivative of HOBt and achieves better performance in terms of yields and racemisation suppression than HBTU.
Formula:C15H20F6N5OPPurity:Min. 95%Color and Shape:SolidMolecular weight:431.32 g/mol




