CymitQuimica logo

CAS 105384-16-5

:

1-butylpiperidin-4-yl [3-(heptyloxy)phenyl]carbamate hydrochloride

Description:
1-Butylpiperidin-4-yl [3-(heptyloxy)phenyl]carbamate hydrochloride is a chemical compound characterized by its complex structure, which includes a piperidine ring, a butyl group, and a phenyl moiety with a heptyloxy substituent. This compound is typically classified as a carbamate, indicating the presence of a carbamate functional group (-OC(=O)NR2), which is known for its potential biological activity. The hydrochloride salt form suggests enhanced solubility in water, making it suitable for various applications in pharmaceutical research. The presence of the heptyloxy group may influence its lipophilicity and membrane permeability, potentially affecting its pharmacokinetic properties. Additionally, the piperidine ring is often associated with various biological activities, including analgesic and psychoactive effects. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and drug development, although specific biological activities and therapeutic applications would require further investigation through empirical studies.
Formula:C23H39ClN2O3
InChI:InChI=1/C23H38N2O3.ClH/c1-3-5-7-8-9-18-27-22-12-10-11-20(19-22)24-23(26)28-21-13-16-25(17-14-21)15-6-4-2;/h10-12,19,21H,3-9,13-18H2,1-2H3,(H,24,26);1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • PAK 4437

    CAS:
    <p>Carbamic acid, (3-(hexyloxy)phenyl)-, 1-butyl-4-piperidinyl ester, monohydrochloride (9CI) is a bioactive chemical.</p>
    Formula:C23H39ClN2O3
    Color and Shape:Solid
    Molecular weight:427.02