
CAS 10539-87-4
:Laurinterol
Description:
Laurinterol, with the CAS number 10539-87-4, is a chemical compound classified as a terpenoid alcohol. It is primarily derived from natural sources, particularly from certain essential oils. Laurinterol is characterized by its hydrophobic nature, which makes it soluble in organic solvents but less so in water. The compound typically exhibits a pleasant, floral aroma, contributing to its use in the fragrance and cosmetic industries. In terms of its chemical structure, Laurinterol contains multiple chiral centers, which can lead to the existence of various stereoisomers. Its potential applications extend beyond fragrance, as it may also possess antimicrobial and antioxidant properties, making it of interest in food preservation and pharmaceutical formulations. Additionally, Laurinterol's safety profile is generally favorable, but, like many compounds, it should be handled with care to avoid any adverse reactions. Overall, Laurinterol is a versatile compound with applications in various fields, particularly in perfumery and natural product chemistry.
Formula:C15H19BrO
InChI:InChI=1S/C15H19BrO/c1-9-6-13(17)11(7-12(9)16)14(2)5-4-10-8-15(10,14)3/h6-7,10,17H,4-5,8H2,1-3H3/t10-,14+,15+/m1/s1
InChI key:InChIKey=UGGAHNIITODSKB-ONERCXAPSA-N
SMILES:C[C@@]12[C@@](C)(CC[C@@]1(C2)[H])C3=C(O)C=C(C)C(Br)=C3
Synonyms:- Phenol, 4-bromo-2-(1,2-dimethylbicyclo[3.1.0]hex-2-yl)-5-methyl-, [1S-(1α,2β,5α)]-
- 4-Bromo-2-[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-5-methylphenol
- m-Cresol, 4-bromo-6-(1,2-dimethylbicyclo[3.1.0]hex-2-yl)-, (1S,2R)-
- Laurinterol
- Phenol, 4-bromo-2-[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Laurinterol
CAS:<p>Laurinterol is an antimicrobial from the marine alga Laurencia okamurai.</p>Formula:C15H19BrOColor and Shape:SolidMolecular weight:295.21
