CymitQuimica logo

CAS 105391-69-3

:

5-fluoro-4-methyl-1H-indazole

Description:
5-Fluoro-4-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 5-position and a methyl group at the 4-position contributes to its unique properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anticancer properties. The fluorine substitution can enhance lipophilicity and metabolic stability, making it a valuable scaffold in drug design. Additionally, 5-fluoro-4-methyl-1H-indazole can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are useful in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H7FN2
InChI:InChI=1/C8H7FN2/c1-5-6-4-10-11-8(6)3-2-7(5)9/h2-4H,1H3,(H,10,11)
InChI key:IQDVHNBGTTXLCU-UHFFFAOYSA-N
SMILES:Cc1c2c[nH]nc2ccc1F
Found 5 products.