CAS 105394-84-1

N-Ethyl-3-(hydroxymethyl)benzamide

Description:

N-Ethyl-3-(hydroxymethyl)benzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. It features an ethyl group attached to the nitrogen atom of the amide, contributing to its hydrophobic properties. The presence of a hydroxymethyl group at the meta position of the benzene ring enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound is typically a white to off-white solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in pharmaceuticals or as a chemical intermediate, particularly due to the presence of both hydrophobic and hydrophilic functional groups, which can facilitate interactions with biological systems. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-2-11-10(13)9-5-3-4-8(6-9)7-12/h3-6,12H,2,7H2,1H3,(H,11,13)

InChI key: InChIKey=VPRSFHNVFGKOFN-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C1=CC(CO)=CC=C1

Synonyms:

• Benzamide, N-ethyl-3-(hydroxymethyl)-
• N-Ethyl-3-(hydroxymethyl)benzamide