CAS 10540-32-6

1,1'-Biphenyl, 4'-fluoro-3-nitro-

Description:

1,1'-Biphenyl, 4'-fluoro-3-nitro- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position of one phenyl ring and a nitro group at the meta position of the other ring contributes to its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific conditions. It is known to be soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. The nitro group introduces significant polarity, influencing its interactions in chemical reactions. 1,1'-Biphenyl, 4'-fluoro-3-nitro- may be used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks through inhalation or skin contact.

Formula: C₁₂H₈FNO₂

InChI: InChI=1S/C12H8FNO2/c13-11-6-4-9(5-7-11)10-2-1-3-12(8-10)14(15)16/h1-8H

InChI key: InChIKey=FFZJARKPNHJFMC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1)C2=CC=C(F)C=C2