CymitQuimica logo

CAS 105404-97-5

:

2,7-DIMETHOXY-3,6-BIS(METHYLTHIO)-NAPHTHALENE

Description:
2,7-Dimethoxy-3,6-bis(methylthio)naphthalene is an organic compound characterized by its complex structure, which includes a naphthalene backbone substituted with methoxy and methylthio groups. The presence of two methoxy (-OCH3) groups at the 2 and 7 positions enhances its solubility in organic solvents and may influence its electronic properties, making it potentially useful in various applications such as organic electronics or as a precursor in synthetic chemistry. The methylthio (-SCH3) groups at the 3 and 6 positions contribute to the compound's reactivity and may affect its biological activity. This compound is likely to exhibit moderate to low volatility and may have specific interactions with biological systems, warranting further investigation into its potential pharmacological properties. Additionally, its unique structure may allow for interesting photophysical properties, making it a candidate for studies in materials science. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C14H16O2S2
InChI:InChI=1/C14H16O2S2/c1-15-11-5-9-6-12(16-2)14(18-4)8-10(9)7-13(11)17-3/h5-8H,1-4H3
SMILES:COc1cc2cc(c(cc2cc1SC)SC)OC
Synonyms:
  • 2,7-Dimethoxy-3,6-Bis(Methylsulfanyl)Naphthalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.