CAS 10541-82-9
:ethyl 4-(methylamino)benzoate
Description:
Ethyl 4-(methylamino)benzoate, with the CAS number 10541-82-9, is an organic compound that belongs to the class of esters. It is characterized by the presence of an ethyl group attached to a benzoate moiety, which is further substituted with a methylamino group at the para position of the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl 4-(methylamino)benzoate is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive compounds. It may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many esters. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-3-13-10(12)8-4-6-9(11-2)7-5-8/h4-7,11H,3H2,1-2H3
SMILES:CCOC(=O)c1ccc(cc1)NC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-(Methylamino)benzoic Acid Ethyl Ester
CAS:Controlled ProductFormula:C10H13NO2Color and Shape:NeatMolecular weight:179.22
