CAS 10541-83-0: 4-(Methylamino)benzoic acid
Description:4-(Methylamino)benzoic acid, also known as p-methylaminobenzoic acid, is an aromatic amine and a derivative of benzoic acid. It features a carboxylic acid group (-COOH) and a methylamino group (-NH(CH3)2) attached to a benzene ring, specifically at the para position relative to each other. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the methylamino group can influence its biological activity, making it of interest in pharmaceutical research. Additionally, it may serve as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Safety data should be consulted, as with any chemical substance, to understand its handling and potential hazards.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-9-7-4-2-6(3-5-7)8(10)11/h2-5,9H,1H3,(H,10,11)
InChI key:InChIKey=ZVIDMSBTYRSMAR-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C=C1)NC
- Synonyms:
- 4-(Methylamino)Benzoate
- 4-(N-Methylamino)benzoic acid
- 4-Methylaminobenzoic acid
- Benzoic acid, 4-(methylamino)-
- Benzoic acid, p-(methylamino)-
- N-Methyl-4-aminobenzoic acid
- NSC 102506
- p-(Methylamino)benzoic acid
- p-Carboxy-N-methylaniline
- 4-(Methylamino)benzoic acid
- See more synonyms