CAS 105434-90-0

Ethyl 5-amino-1H-pyrazole-3-carboxylate

Description:

Ethyl 5-amino-1H-pyrazole-3-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an amino group (-NH2) and a carboxylate group (-COOEt) attached to the pyrazole ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various synthetic processes. Ethyl 5-amino-1H-pyrazole-3-carboxylate is often studied for its biological activities, including potential anti-inflammatory and anti-cancer properties. Its molecular structure allows for various modifications, which can lead to the development of derivatives with enhanced pharmacological effects. Additionally, the compound's stability under standard laboratory conditions makes it a valuable intermediate in organic synthesis. As with many nitrogen-containing heterocycles, it may also exhibit interesting coordination chemistry with metal ions, further expanding its utility in research and industrial applications.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c1-2-11-6(10)4-3-5(7)9-8-4/h3H,2H2,1H3,(H3,7,8,9)

SMILES: CCOC(=O)c1cc(=N)[nH][nH]1

Synonyms:

• 1H-pyrazole-3-carboxylic acid, 5-amino-, ethyl ester
• 1H-pyrazole-5-carboxylic acid, 3-amino-, ethyl ester
• 5-Amino-1H-pyrazole-3-carboxylic acid ethyl ester
• ethyl 3-amino-1H-pyrazole-5-carboxylate

Ethyl 3-amino-1H-pyrazole-5-carboxylate

CAS: 105434-90-0

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.1546

Ref: IN-DA003QC4

Ethyl 5-amino-1H-pyrazole-3-carboxylate

CAS: 105434-90-0

Ethyl 5-amino-1H-pyrazole-3-carboxylate

Purity: 99%

Molecular weight: 155.16g/mol

Ref: 54-OR75074

Ethyl 5-Amino-1H-pyrazole-3-carboxylate

CAS: 105434-90-0

Formula: C₆H₉N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.157

Ref: 10-F066990