
CAS 10546-24-4
:3-Methyl-2-naphthalenamine
Description:
3-Methyl-2-naphthalenamine, with the CAS number 10546-24-4, is an organic compound belonging to the class of naphthalenamines. It features a naphthalene ring system substituted with an amino group and a methyl group, which contributes to its chemical properties. This compound is typically a solid at room temperature and is characterized by its aromatic structure, which imparts stability and unique reactivity. It is known for its potential applications in the synthesis of dyes, pigments, and other organic compounds due to its ability to participate in various chemical reactions, such as electrophilic aromatic substitution. Additionally, 3-Methyl-2-naphthalenamine may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its solubility in organic solvents and limited solubility in water are typical for compounds of this nature, influencing its behavior in different chemical environments. Overall, 3-Methyl-2-naphthalenamine is a valuable compound in organic synthesis and materials science.
Formula:C11H11N
InChI:InChI=1S/C11H11N/c1-8-6-9-4-2-3-5-10(9)7-11(8)12/h2-7H,12H2,1H3
InChI key:InChIKey=BJICIOTXNBTOAJ-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1N)C=CC=C2
Synonyms:- 2-Amino-3-methylnaphthalene
- 3-Methyl-2-naphthylamine
- 2-Naphthylamine, 3-methyl-
- 3-Methyl-2-naphthalenamine
- 2-Naphthalenamine, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
