CAS 10546-70-0

N-Propylbenzamide

Description:

N-Propylbenzamide is an organic compound characterized by its amide functional group, where a propyl group is attached to the nitrogen atom of benzamide. It has a molecular formula of C11H15NO, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. N-Propylbenzamide is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. It exhibits a moderate boiling point and melting point, which are characteristic of amides. The compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, N-Propylbenzamide may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c1-2-8-11-10(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,11,12)

InChI key: InChIKey=DYZWXBMTHNHXML-UHFFFAOYSA-N

SMILES: C(NCCC)(=O)C1=CC=CC=C1

Synonyms:

• N-Propylbenzamide
• NSC 20562
• N-(n-Propyl)benzamide
• Benzamide, N-propyl-