
CAS 10547-30-5
:N-(2,4-Dinitrophenyl)serine
Description:
N-(2,4-Dinitrophenyl)serine is a chemical compound characterized by its structure, which includes a serine amino acid moiety linked to a 2,4-dinitrophenyl group. This compound is often used in biochemical research, particularly in studies involving enzyme activity and protein modification. The presence of the dinitrophenyl group imparts significant reactivity, making it useful for labeling and detecting proteins. N-(2,4-Dinitrophenyl)serine is typically a solid at room temperature and is soluble in organic solvents, which facilitates its use in various laboratory applications. Its reactivity can lead to the formation of stable adducts with nucleophiles, such as amino acids and proteins, allowing for the investigation of protein structure and function. Additionally, due to the presence of the dinitrophenyl group, it can absorb UV light, making it useful in spectroscopic analyses. Safety precautions should be taken when handling this compound, as dinitrophenyl derivatives can be hazardous and potentially toxic.
Formula:C9H9N3O7
InChI:InChI=1S/C9H9N3O7/c13-4-7(9(14)15)10-6-2-1-5(11(16)17)3-8(6)12(18)19/h1-3,7,10,13H,4H2,(H,14,15)
InChI key:InChIKey=SBQZBOCQYMVLTC-UHFFFAOYSA-N
SMILES:N(C(C(O)=O)CO)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1
Synonyms:- Serine, N-(2,4-dinitrophenyl)-
- N-(2,4-Dinitrophenyl)-DL-serine
- DL-Serine, N-(2,4-dinitrophenyl)-
- N-(2,4-Dinitrophenyl)serine
- Serine, N-(2,4-dinitrophenyl)-, DL-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.