
CAS 10547-33-8
:N-(2,4-Dinitrophenyl)valine
Description:
N-(2,4-Dinitrophenyl)valine is an organic compound characterized by the presence of a valine amino acid moiety linked to a 2,4-dinitrophenyl group. This compound features a dinitrophenyl group, which is known for its electron-withdrawing properties due to the presence of two nitro groups, influencing the reactivity and polarity of the molecule. Valine, an essential amino acid, contributes to the compound's biological relevance, particularly in protein synthesis and metabolic processes. The presence of the dinitrophenyl group can also enhance the compound's ability to participate in various chemical reactions, making it useful in biochemical applications, such as labeling or as a reagent in organic synthesis. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and can be sensitive to light and moisture. Safety considerations are important, as dinitrophenyl compounds can be hazardous, necessitating careful handling and storage. Overall, N-(2,4-Dinitrophenyl)valine serves as a valuable compound in both research and industrial applications.
Formula:C11H13N3O6
InChI:InChI=1S/C11H13N3O6/c1-6(2)10(11(15)16)12-8-4-3-7(13(17)18)5-9(8)14(19)20/h3-6,10,12H,1-2H3,(H,15,16)
InChI key:InChIKey=AYLCDVYHZOZQKM-UHFFFAOYSA-N
SMILES:N(C(C(C)C)C(O)=O)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1
Synonyms:- Valine, N-(2,4-dinitrophenyl)-
- 2,4-Dinitrophenyl-DL-valine
- Valine, N-(2,4-dinitrophenyl)-, DL-
- N-(2,4-Dinitrophenyl)valine
- DL-Valine, N-(2,4-dinitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.