CAS 105471-98-5

Calceolarioside B

Description:

Calceolarioside B is a naturally occurring chemical compound classified as a phenolic glycoside. It is primarily derived from plants in the Calceolaria genus, which are known for their ornamental flowers and potential medicinal properties. The compound features a complex structure that includes a sugar moiety linked to a phenolic aglycone, contributing to its biological activity. Calceolarioside B has been studied for its potential antioxidant and anti-inflammatory effects, which may be attributed to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, it may exhibit antimicrobial properties, making it of interest in pharmacological research. The compound's solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy in biological systems. Overall, Calceolarioside B represents a significant area of study within natural product chemistry, with implications for both therapeutic applications and understanding plant secondary metabolites.

Formula: C₂₃H₂₆O₁₁

InChI: InChI=1S/C23H26O11/c24-14-4-1-12(9-16(14)26)3-6-19(28)33-11-18-20(29)21(30)22(31)23(34-18)32-8-7-13-2-5-15(25)17(27)10-13/h1-6,9-10,18,20-27,29-31H,7-8,11H2/b6-3+/t18-,20-,21+,22-,23-/m1/s1

InChI key: InChIKey=LFKQVVDFNHDYNK-FOXCETOMSA-N

SMILES: O(CCC1=CC(O)=C(O)C=C1)[C@@H]2O[C@H](COC(/C=C/C3=CC(O)=C(O)C=C3)=O)[C@@H](O)[C@H](O)[C@H]2O

Synonyms:

• Calceolarioside B
• Desrhamnosyl Isoacteoside
• Zinc 14512219
• b-D-Glucopyranoside,2-(3,4-dihydroxyphenyl)ethyl, 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
• β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
• β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
• Desrhamnosylisoacteoside
• β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]

Desrhamnosyl isoacteoside

CAS: 105471-98-5

Formula: C₂₃H₂₆O₁₁

Purity: 98%

Molecular weight: 478.4459

Ref: IN-DA008T3R

Calceolarioside B

CAS: 105471-98-5

Calceolarioside B

Purity: ≥95%

Molecular weight: 478.45g/mol

Ref: 54-BUP02928

Calceolarioside B

CAS: 105471-98-5

Formula: C₂₃H₂₆O₁₁

Molecular weight: 478.45

Ref: 7W-GY5312

Calceolarioside B

CAS: 105471-98-5

Calceolarioside B (Desrhamnosyl isoacteoside) displays inhibition of aromatase. Calceolarioside B displays inhibition of human recombinant PKCalpha.

Formula: C₂₃H₂₆O₁₁

Purity: 95.8% - 99.82%

Color and Shape: Solid

Molecular weight: 478.45

Ref: TM-T3899

Calceolarioside B

CAS: 105471-98-5

Formula: C₂₃H₂₆O₁₁

Purity: 95%~99%

Molecular weight: 478.45

Ref: BP-BP0303

Calceolarioside b

CAS: 105471-98-5

Natural glycoside

Formula: C₂₃H₂₆O₁₁

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 478.45

Ref: 5G-83482

Calceolarioside B

CAS: 105471-98-5

Calceolarioside B is a phenylethanoid glycoside, which is a type of secondary metabolite commonly found in various plant species. It is primarily isolated from the Scrophulariaceae family, although it can be present in other related botanical sources. This compound is characterized by its potent antioxidant properties, contributing to its role in mitigating oxidative stress at the cellular level.

Formula: C₂₃H₂₆O₁₁

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 478.45 g/mol

Ref: 3D-FC73992