CAS 105471-98-5: Calceolarioside B
Description:Calceolarioside B is a naturally occurring chemical compound classified as a phenolic glycoside. It is primarily derived from plants in the Calceolaria genus, which are known for their ornamental flowers and potential medicinal properties. The compound features a complex structure that includes a sugar moiety linked to a phenolic aglycone, contributing to its biological activity. Calceolarioside B has been studied for its potential antioxidant and anti-inflammatory effects, which may be attributed to its ability to scavenge free radicals and modulate various biochemical pathways. Additionally, it may exhibit antimicrobial properties, making it of interest in pharmacological research. The compound's solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy in biological systems. Overall, Calceolarioside B represents a significant area of study within natural product chemistry, with implications for both therapeutic applications and understanding plant secondary metabolites.
Formula:C23H26O11
InChI:InChI=1S/C23H26O11/c24-14-4-1-12(9-16(14)26)3-6-19(28)33-11-18-20(29)21(30)22(31)23(34-18)32-8-7-13-2-5-15(25)17(27)10-13/h1-6,9-10,18,20-27,29-31H,7-8,11H2/b6-3+/t18-,20-,21+,22-,23-/m1/s1
InChI key:InChIKey=LFKQVVDFNHDYNK-FOXCETOMSA-N
SMILES:O=C(OCC1OC(OCCC2=CC=C(O)C(O)=C2)C(O)C(O)C1O)C=CC3=CC=C(O)C(O)=C3
- Synonyms:
- Calceolarioside B
- Desrhamnosyl Isoacteoside
- Zinc 14512219
- b-D-Glucopyranoside,2-(3,4-dihydroxyphenyl)ethyl, 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- Desrhamnosylisoacteoside
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl, 6-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
