CAS 105479-86-5

MALONALDEHYDE-1,3-D2 BIS(DIETHYL ACETAL)

Description:

Malonaldehyde-1,3-D2 bis(diethyl acetal) is a chemical compound characterized by its structure, which includes two diethyl acetal groups attached to a malonaldehyde backbone. This compound is notable for its deuterated form, indicated by the "D2" in its name, which refers to the presence of deuterium isotopes of hydrogen. The presence of deuterium can influence the compound's physical and chemical properties, such as its stability and reactivity, making it useful in various applications, including studies in organic synthesis and isotope labeling. Typically, compounds like this are utilized in research settings, particularly in the fields of organic chemistry and biochemistry, where they may serve as intermediates or tracers. The diethyl acetal groups contribute to the compound's solubility and reactivity, allowing for potential applications in the synthesis of more complex molecules. Overall, malonaldehyde-1,3-D2 bis(diethyl acetal) is a specialized compound with unique characteristics that make it valuable in scientific research.

Formula: C₉D₂₀O₄

InChI: InChI=1/C9H20O4/c1-5-10-9(11-6-2,12-7-3)13-8-4/h5-8H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,7D2,8D2

SMILES: C(C(OC(OC(C([2H])([2H])[2H])([2H])[2H])(OC(C([2H])([2H])[2H])([2H])[2H])OC(C([2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])([2H])[2H]

Malonaldehyde-1,3-d2 Bis(diethyl Acetal)

CAS: 105479-86-5

Formula: (CH₃CH₂O)₂CDCH₂CD(OCH₂CH₃)₂

Purity: 96 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 222.18001

Ref: 3U-D6469

1,1,3,3-Tetraethoxypropane-1,3-d2

Controlled Product

CAS: 105479-86-5

Applications The precursor of the ubiquitous natural compound malondialdehyde.
References Basu, A.K., et al.: J. of Labelled Compounds & Radiopharmaceuticals, XX11, 11, 1175 (1985)

Formula: C₁₁₂H₂H₂₂O₄

Color and Shape: Colourless

Molecular weight: 222.32

Ref: TR-T292955