CAS 105479-87-6

1,3-Dithiane-2-d, 2,2′-methylenebis-

Description:

1,3-Dithiane-2-d, 2,2′-methylenebis- is a chemical compound characterized by its unique structure, which includes a dithiane ring and a methylene bridge. The presence of the dithiane moiety imparts specific properties, such as increased stability and reactivity in various chemical reactions, particularly in nucleophilic substitutions and cycloadditions. This compound is notable for its isotopic labeling, indicated by the "2-d" designation, which suggests the presence of deuterium, a stable isotope of hydrogen. This isotopic labeling can be useful in studies involving reaction mechanisms and kinetics. The compound's molecular structure contributes to its solubility in organic solvents, making it suitable for various synthetic applications in organic chemistry. Additionally, its unique features may allow for specific interactions in biological systems, although detailed biological activity would require further investigation. Overall, 1,3-Dithiane-2-d, 2,2′-methylenebis- serves as an interesting subject for research in both synthetic and analytical chemistry contexts.

Formula: C₉H₁₄D₂S₄

InChI: InChI=1S/C9H16S4/c1-3-10-8(11-4-1)7-9-12-5-2-6-13-9/h8-9H,1-7H2/i8D,9D

InChI key: InChIKey=DCJKPLNHQJEQOL-XETGXLELSA-N

SMILES: C(C1(SCCCS1)[2H])C2(SCCCS2)[2H]

Synonyms:

• 1,3-Dithiane-2-d, 2,2′-methylenebis-
• 2,2'-Methylenebis-1,3-dithiane-2-d
• 2-Deuterio-2-[(2-deuterio-1,3-dithian-2-yl)methyl]-1,3-dithiane

Bis(1,3-dithian-2-yl)methane-d2

Controlled Product

CAS: 105479-87-6

Applications Bis(1,3-dithian-2-yl)methane-d2 (cas# 105479-87-6) is a compound useful in organic synthesis.

Formula: C₉₂H₂H₁₄S₄

Color and Shape: Neat

Molecular weight: 254.50

Ref: TR-B431752