CAS 10548-46-6
:1,6-ANHYDRO-2,3,4-TRI-O-BENZYL-BETA-D-GLUCOPYRANOSE
Description:
1,6-Anhydro-2,3,4-tri-O-benzyl-beta-D-glucopyranose is a chemical compound that belongs to the class of glycosides, specifically a derivative of glucose. It features a glucopyranose ring structure with three benzyl groups attached to the hydroxyl positions at C-2, C-3, and C-4, while the anhydro form indicates the absence of a hydroxyl group at C-6 due to the formation of a cyclic ether. This compound is characterized by its relatively high molecular weight and lipophilicity due to the presence of the benzyl groups, which can influence its solubility and reactivity. It is typically used in organic synthesis and carbohydrate chemistry, often serving as an intermediate in the preparation of more complex glycosides or as a protective group in carbohydrate synthesis. The compound may exhibit interesting biological activities, although specific studies would be required to elucidate its pharmacological properties. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C27H28O5
InChI:InChI=1/C27H28O5/c1-4-10-20(11-5-1)16-28-24-23-19-31-27(32-23)26(30-18-22-14-8-3-9-15-22)25(24)29-17-21-12-6-2-7-13-21/h1-15,23-27H,16-19H2/t23-,24-,25+,26-,27-/m1/s1
Synonyms:- 1,6-Anhydro-2,3,4-Tri-O-Benzyl-B-D-Glucopyranose
- 1,6-Anhydro-2,3,4-Tri-O-Benzyl-Beta-D-Glucose
- 1,6-Anhydro-2,3,4-tri-o-benyl-b-D-glucopyranose
- 1,6-Anhydro-2,3,4-Tri-O-Benzyl-Ss-D-Glucopyranose
- (1R,2R,3S,4R,5R)-2,3,4-tris(benzyloxy)-6,8-dioxabicyclo[3.2.1]octane (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,6-Anhydro-2,3,4-tri-O-benzyl-β-D-glucopyranose
CAS:Formula:C27H28O5Color and Shape:SolidMolecular weight:432.522,3,4-Tri-O-benzyl-1,6-anhydro-β-D-glucopyranose
CAS:<p>2,3,4-Tri-O-benzyl-1,6-anhydro-β-D-glucopyranose</p>Purity:>98%Molecular weight:432.51g/mol1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose
CAS:<p>1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose is a polymer that can be synthesized by copolymerizing the monomer with other reagents. The acetal linkage between the two glucose units allows for a cyclic structure, and this compound is soluble in water and methanol. 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose has been used to synthesize a variety of polymers such as polyacetals and polyesters.</p>Formula:C27H28O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:432.51 g/mol1,6-Anhydro-2,3,4-tri-O-benzyl-β-D-glucopyranose
CAS:Controlled ProductFormula:C27H28O5Color and Shape:NeatMolecular weight:432.51




