CAS 10548-61-5
:benzyl-beta-D-xyloside
Description:
Benzyl-beta-D-xyloside is a glycoside compound characterized by the presence of a benzyl group attached to the anomeric carbon of beta-D-xylopyranose. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is often used in biochemical research, particularly in studies involving glycosylation and carbohydrate interactions. The presence of the benzyl group enhances its hydrophobic properties, which can influence its reactivity and interactions with other biomolecules. Benzyl-beta-D-xyloside can serve as a substrate for various glycosyltransferases, making it valuable in enzymatic assays. Additionally, it may exhibit biological activities, including potential roles in cell signaling or as a precursor in the synthesis of more complex carbohydrates. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use. Overall, benzyl-beta-D-xyloside is a significant compound in the field of carbohydrate chemistry and biochemistry.
Formula:C12H16O5
InChI:InChI=1/C12H16O5/c13-9-7-17-12(11(15)10(9)14)16-6-8-4-2-1-3-5-8/h1-5,9-15H,6-7H2/t9-,10+,11-,12-/m1/s1
Synonyms:- beta-D-Xylopyranoside, phenylmethyl
- benzyl beta-D-xylopyranoside
- Benzyl-beta-D-xyloside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzyl b-D-xylopyranoside
CAS:<p>Benzyl b-D-xylopyranoside is an inorganic compound that is used as a radioactive tracer to study the movement of fluid and macromolecules in the apical membrane of the chondrocyte. It was shown to be effective in preventing the formation of tissue-damaging acute phase proteins when administered at a time point corresponding to the onset of an acute inflammatory response. Benzyl b-D-xylopyranoside has also been shown to have regulatory effects on untreated control cells, but not on untreated control cells. This drug inhibits biosynthesis of GAGs, which are molecules that provide structural support for cells and tissues. The mechanism by which benzyl b-D-xylopyranoside exerts its effect is not yet known.</p>Formula:C12H16O5Purity:Min. 95%Molecular weight:240.25 g/mol
