CAS 10549-59-4
:DIMETHYLETHANOLAMINESUCCINATE
Description:
Dimethylethanolaminesuccinate, with the CAS number 10549-59-4, is an organic compound characterized by its amine and carboxylate functional groups. It is a derivative of succinic acid, featuring dimethylated ethanolamine moieties, which contribute to its amphiphilic nature. This compound typically appears as a colorless to pale yellow liquid and is soluble in water, making it useful in various applications, particularly in the fields of pharmaceuticals and cosmetics. Its structure allows it to function as a surfactant, emulsifier, or stabilizer, enhancing the solubility and bioavailability of active ingredients in formulations. Additionally, dimethylethanolaminesuccinate may exhibit mild irritant properties, necessitating careful handling. Its compatibility with other ingredients and its ability to modify surface tension make it valuable in product development, particularly in formulations requiring improved texture and stability. Overall, this compound's unique chemical properties and functional versatility make it an important ingredient in various industrial applications.
Formula:C8H17NO5
InChI:InChI=1/C4H11NO.C4H6O4/c1-5(2)3-4-6;5-3(6)1-2-4(7)8/h6H,3-4H2,1-2H3;1-2H2,(H,5,6)(H,7,8)
SMILES:CN(C)CCO.C(CC(=O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tonibral
CAS:Controlled Product<p>Tonibral is a synthetic surfactant that can be used in pharmaceutical formulations and as a coating for medical devices. It is also used as a neuroprotective agent and an analytical reagent. Tonibral has been shown to have long-term effects on the muscle, which may be due to its ability to reduce biogenic amines and increase the flow rate of blood vessels in the brain. Tonibral is synthesized by combining two chemicals, one that contains a long hydrophobic chain (e.g., octadecanol) and one with a hydrophilic head group (e.g., sodium dodecyl sulfate). This synthesis can be accomplished in two ways: 1) through the condensation of octadecanol with sodium dodecyl sulfate or 2) through the reaction of octadecanol with sodium dodecyl sulfate and sulfuric acid. Tonibral can also be synthesized by reacting 8-hydroxyquinoline with sodium</p>Formula:C8H15NO4Purity:Min. 95%Molecular weight:189.21 g/mol
