CymitQuimica logo

CAS 105496-34-2

:

5-Mercapto-N,N,3-trimethyl-L-histidine

Description:
5-Mercapto-N,N,3-trimethyl-L-histidine, identified by its CAS number 105496-34-2, is an organic compound that features a histidine backbone modified with a mercapto group and trimethylation. This compound is characterized by the presence of a thiol (-SH) group, which imparts unique reactivity and potential antioxidant properties. The trimethylation at the nitrogen atom enhances its lipophilicity and may influence its biological activity and solubility in various solvents. As a derivative of histidine, it retains the imidazole ring, which is crucial for its role in biological systems, particularly in enzyme catalysis and metal ion coordination. The compound may be of interest in biochemical research, particularly in studies related to protein structure, function, and interactions. Its potential applications could extend to pharmaceuticals, where modifications of amino acids can lead to novel therapeutic agents. However, specific properties such as melting point, solubility, and stability would require empirical data for precise characterization.
Formula:C9H15N3O2S
InChI:InChI=1S/C9H15N3O2S/c1-11(2)7(9(13)14)4-6-8(15)10-5-12(6)3/h5,7,15H,4H2,1-3H3,(H,13,14)/t7-/m0/s1
InChI key:InChIKey=ONAWDGXCZMVYMN-ZETCQYMHSA-N
SMILES:C([C@@H](C(O)=O)N(C)C)C1=C(S)N=CN1C
Synonyms:
  • L-Histidine, 5-mercapto-N,N,3-trimethyl-
  • Ovothiol C
  • 5-Mercapto-N,N,3-trimethyl-L-histidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.