CAS 10550-79-5
:1,1,2,2-Propanetetracarbonxamide
Description:
1,1,2,2-Propanetetracarboxamide, with the CAS number 10550-79-5, is an organic compound characterized by its four carboxamide functional groups attached to a propane backbone. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents due to the presence of the amide groups, which can engage in hydrogen bonding. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of multiple amide groups can enhance its ability to form hydrogen bonds, influencing its physical properties such as melting point and solubility. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. However, specific reactivity and stability characteristics would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species. Overall, 1,1,2,2-Propanetetracarboxamide is notable for its complex structure and potential utility in various chemical applications.
Formula:C7H12N4O4
InChI:InChI=1/C7H12N4O4/c8-4(12)2(5(9)13)1-3(6(10)14)7(11)15/h2-3H,1H2,(H2,8,12)(H2,9,13)(H2,10,14)(H2,11,15)
Synonyms:- propane-1,1,3,3-tetracarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
