CAS 105512-83-2

4-[4-(Phenylmethoxy)phenyl]-2-thiazolamine

Description:

4-[4-(Phenylmethoxy)phenyl]-2-thiazolamine, identified by its CAS number 105512-83-2, is an organic compound characterized by its thiazole and amine functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, contributing to its potential biological activity. The presence of the phenylmethoxy group indicates that it has an ether linkage, which can influence its solubility and reactivity. The compound's structure suggests it may exhibit properties relevant to medicinal chemistry, potentially acting as a scaffold for drug development. Its specific interactions, such as binding affinity to biological targets, would depend on the spatial arrangement of its substituents and the overall molecular conformation. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-[4-(Phenylmethoxy)phenyl]-2-thiazolamine represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.

Formula: C₁₆H₁₄N₂OS

InChI: InChI=1S/C16H14N2OS/c17-16-18-15(11-20-16)13-6-8-14(9-7-13)19-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,17,18)

InChI key: InChIKey=WIHRKMVWGOESGZ-UHFFFAOYSA-N

SMILES: NC1=NC(=CS1)C2=CC=C(OCC3=CC=CC=C3)C=C2

4-[4-(Benzyloxy)phenyl]-1,3-thiazol-2-amine

CAS: 105512-83-2

Versatile small molecule scaffold

Formula: C₁₆H₁₄N₂OS

Purity: Min. 95%

Molecular weight: 282.4 g/mol

Ref: 3D-FEA51283