CAS 105523-01-1

(5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-6-yl)acetic acid

Description:

(5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-6-yl)acetic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates both thieno and pyrimidine rings. This compound features a methyl group and a keto group, contributing to its reactivity and potential biological activity. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, which can influence its solubility and interaction with biological systems. The compound's structure allows for various functional group interactions, making it a candidate for pharmaceutical applications, particularly in the development of therapeutics targeting specific biological pathways. Its CAS number, 105523-01-1, serves as a unique identifier for regulatory and research purposes. Overall, this compound's distinctive structural features and functional groups may contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₉H₈N₂O₃S

InChI: InChI=1/C9H8N2O3S/c1-4-5(2-6(12)13)15-9-7(4)8(14)10-3-11-9/h3H,2H2,1H3,(H,12,13)(H,10,11,14)