
CAS 105533-77-5
:1-Methyl-1H-pyrrole-2-carboximidamide
Description:
1-Methyl-1H-pyrrole-2-carboximidamide is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing one nitrogen atom. This compound features a methyl group attached to the nitrogen of the pyrrole, as well as a carboximidamide functional group, which contributes to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. The presence of the carboximidamide moiety suggests that it may participate in hydrogen bonding, influencing its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant in the development of pharmaceuticals. Additionally, its unique properties may allow it to act as a ligand in coordination chemistry or as an intermediate in organic synthesis. However, specific applications and biological activities would require further investigation and research to fully understand its potential uses.
Formula:C6H9N3
InChI:InChI=1S/C6H9N3/c1-9-4-2-3-5(9)6(7)8/h2-4H,1H3,(H3,7,8)
InChI key:InChIKey=ZFQYRAGTMAIVON-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1N(C)C=CC1
Synonyms:- 1-Methyl-1H-pyrrole-2-carboximidamide
- 1H-Pyrrole-2-carboximidamide, 1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.