CAS 105537-98-2
:6-Methyl-5-phenyl-3-pyridazinamine
Description:
6-Methyl-5-phenyl-3-pyridazinamine, with the CAS number 105537-98-2, is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methyl group and a phenyl group attached to the pyridazine core, contributing to its unique chemical properties. It is typically classified as an organic amine due to the presence of an amino group. The presence of both the methyl and phenyl substituents can influence its solubility, reactivity, and potential applications in pharmaceuticals or agrochemicals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance. Overall, 6-Methyl-5-phenyl-3-pyridazinamine represents a versatile structure within the realm of heterocyclic compounds.
Formula:C11H11N3
InChI:InChI=1S/C11H11N3/c1-8-10(7-11(12)14-13-8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,12,14)
InChI key:InChIKey=NBZANAIVXBVNEU-UHFFFAOYSA-N
SMILES:CC1=C(C=C(N)N=N1)C2=CC=CC=C2
Synonyms:- 3-Pyridazinamine, 6-methyl-5-phenyl-
- 6-Methyl-5-phenyl-3-pyridazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.