
CAS 105538-01-0
:6-(2-Thienyl)-3-pyridazinamine
Description:
6-(2-Thienyl)-3-pyridazinamine is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a thienyl substituent. The presence of the thienyl group, a five-membered aromatic ring containing sulfur, contributes to the compound's potential reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen and sulfur atoms, which can influence the compound's interaction with biological targets. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the thienyl and pyridazine moieties. As with many heterocyclic compounds, it is essential to consider its stability, reactivity, and potential toxicity when evaluating its practical applications. Further studies would be necessary to fully understand its properties and potential uses in various fields, including drug development and materials science.
Formula:C8H7N3S
InChI:InChI=1S/C8H7N3S/c9-8-4-3-6(10-11-8)7-2-1-5-12-7/h1-5H,(H2,9,11)
InChI key:InChIKey=XYMCIICHEPYEJZ-UHFFFAOYSA-N
SMILES:NC1=CC=C(N=N1)C2=CC=CS2
Synonyms:- 6-(2-Thienyl)-3-pyridazinamine
- 3-Pyridazinamine, 6-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.