CAS 105538-73-6
:4-[6-imino-3-(4-methoxyphenyl)pyridazin-1-yl]butanoic acid
Description:
4-[6-Imino-3-(4-methoxyphenyl)pyridazin-1-yl]butanoic acid, with the CAS number 105538-73-6, is a chemical compound characterized by its unique structural features, including a pyridazine ring and a butanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility and reactivity. The presence of the methoxy group on the phenyl ring can enhance its lipophilicity and may also affect its biological activity. The imino group contributes to the compound's potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the butanoic acid functional group suggests potential for interactions with biological systems, possibly indicating applications in pharmaceuticals or agrochemicals. Overall, the compound's characteristics, including its molecular structure and functional groups, suggest a diverse range of potential applications in medicinal chemistry and material science. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C15H17N3O3
InChI:InChI=1/C15H17N3O3/c1-21-12-6-4-11(5-7-12)13-8-9-14(16)18(17-13)10-2-3-15(19)20/h4-9,16H,2-3,10H2,1H3,(H,19,20)
SMILES:COc1ccc(cc1)c1ccc(=N)n(CCCC(=O)O)n1
Synonyms:- 1(6H)-pyridazinebutanoic acid, 6-imino-3-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Gabazine free base
CAS:Gabazine free base is a specific antagonist of the GABA receptor. It does not affect GABA-transaminase or glutamate-decarboxylase activities.Formula:C15H17N3O3Color and Shape:SolidMolecular weight:287.31Gabazine
CAS:Applications A specific GABA receptor antagonist. Does not affect GABA-transaminase or glutamate-decarboxylase activitites.
References Wermuth, et al.: TIPS, 7, 421 (1986), Heaulme, et al.: Brain Res., 384, 224 (19986), Hamann, M., et al.: Brain Res., 442, 287 (1988),Formula:C15H18N3O3·BrColor and Shape:NeatMolecular weight:287.31

