
CAS 105538-79-2
:6-Chloro-3-methyl-4-phenylpyridazine
Description:
6-Chloro-3-methyl-4-phenylpyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 6-position and a methyl group at the 3-position, along with a phenyl group at the 4-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridazine moiety, which is often associated with biological activity. The chlorine substituent can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the phenyl group may enhance lipophilicity, affecting the compound's pharmacokinetics. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 6-Chloro-3-methyl-4-phenylpyridazine would depend on its concentration and exposure conditions.
Formula:C11H9ClN2
InChI:InChI=1S/C11H9ClN2/c1-8-10(7-11(12)14-13-8)9-5-3-2-4-6-9/h2-7H,1H3
InChI key:InChIKey=BXIMWSWKTXKIST-UHFFFAOYSA-N
SMILES:CC1=C(C=C(Cl)N=N1)C2=CC=CC=C2
Synonyms:- 6-Chloro-3-methyl-4-phenylpyridazine
- Pyridazine, 6-chloro-3-methyl-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.