CAS 10554-64-0

2-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)ETHANAMINE HYDROCHLORIDE

Description:

2-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety and an ethanamine group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in research and pharmaceuticals. The presence of the benzodioxin ring contributes to its potential biological activity, which may include interactions with neurotransmitter systems or other biochemical pathways. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Its specific applications may vary, but it is generally of interest in medicinal chemistry and pharmacological studies. Always refer to the latest literature for detailed information regarding its properties and potential uses.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1/C10H13NO2/c11-4-3-8-1-2-9-10(7-8)13-6-5-12-9/h1-2,7H,3-6,11H2

SMILES: c1cc2c(cc1CCN)OCCO2

Synonyms:

• 2-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)Ethanaminium
• 2-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)Ethanamine

2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-amine

Controlled Product

CAS: 10554-64-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-KAA55464