CAS 10555-30-3

3,6-Dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one

Description:

3,6-Dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a fused bicyclic system, which contributes to its potential biological activity. It typically exhibits a moderate to high polarity due to the presence of nitrogen atoms in its rings, influencing its solubility in various solvents. The compound may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of functional groups can lead to diverse reactivity, making it suitable for further chemical modifications. The compound's stability and reactivity are influenced by the electronic properties of the nitrogen atoms and the overall ring system. Overall, 3,6-Dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one represents a valuable scaffold in the development of new chemical entities in drug discovery.

Formula: C₄H₃N₅O

InChI: InChI=1S/C4H3N5O/c10-4-2-3(5-1-6-4)8-9-7-2/h1H,(H2,5,6,7,8,9,10)

InChI key: InChIKey=OEEYCNOOAHGFHL-UHFFFAOYSA-N

SMILES: O=C1C2=C(NC=N1)N=NN2

Synonyms:

• 3,6-Dihydro-7H-1,2,3-triazolo[4,5-d]pyrimidin-7-one
• 7H-1,2,3-Triazolo[4,5-d]pyrimidin-7-one, 1,4-dihydro-
• 7H-v-Triazolo[4,5-d]pyrimidin-7-one, 1,6-dihydro-
• 7H-1,2,3-Triazolo[4,5-d]pyrimidin-7-one, 3,6-dihydro-
• 8-Azahypoxanthine