CAS 105551-42-6
:Hydroxymethanesulfonyloxyiodobenzene
Description:
Hydroxymethanesulfonyloxyiodobenzene, with the CAS number 105551-42-6, is a chemical compound that features a complex structure incorporating a hydroxymethyl group, a sulfonate moiety, and an iodine atom attached to a benzene ring. This compound is characterized by its potential use in organic synthesis and medicinal chemistry, particularly as a reagent in various chemical reactions. The presence of the sulfonate group enhances its solubility in polar solvents, while the iodine atom can participate in electrophilic substitution reactions. Hydroxymethanesulfonyloxyiodobenzene may exhibit unique reactivity patterns due to the interplay between its functional groups, making it valuable in the development of pharmaceuticals or as an intermediate in synthetic pathways. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, handling should be conducted with care, considering potential hazards associated with its components, particularly the iodine, which can be toxic and irritative.
Formula:C7H9IO4S
InChI:InChI=1/C7H9IO4S/c1-13(10,11)12-8(9)7-5-3-2-4-6-7/h2-6,9H,1H3
SMILES:CS(=O)(=O)OI(c1ccccc1)O
Synonyms:- [Hydroxy(methanesulfonyloxy)iodo]benzene
- Hydroxy[(Methylsulfonyl)Oxy]Phenyl-Lambda~3~-Iodane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[Hydroxy(methanesulfonyloxy)iodo]benzene
CAS:Formula:C7H9IO4SPurity:98%Color and Shape:SolidMolecular weight:316.1134[Hydroxy(methanesulfonyloxy)iodo]benzene
CAS:Formula:C7H9IO4SPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:316.11[Hydroxy(methanesulfonyloxy)iodo]benzene
CAS:<p>[Hydroxy(methanesulfonyloxy)iodo]benzene is an aromatic ketone that is used as a ligand in asymmetric synthesis. It is prepared by the reaction of phenyliodonium hexafluorophosphate with a mixture of water and hexane, followed by hydrolysis of the resulting ester. The reaction yields enol ethers and alicyclic ketones, along with the conjugate base of the aromatic ketone. This ligand can be used to form a complex with copper metal ions, which is then used for catalyzing organic reactions.</p>Formula:C7H9IO4SPurity:Min. 95%Molecular weight:316.11 g/mol


