CAS 105552-66-7

Benzene, 2-(difluoromethoxy)-1,3-dimethyl-4-nitro-

Description:

Benzene, 2-(difluoromethoxy)-1,3-dimethyl-4-nitro- is an organic compound characterized by its aromatic benzene ring substituted with various functional groups. The presence of a nitro group (-NO2) at the para position, along with a difluoromethoxy group (-O-CHF2) and two methyl groups (-CH3) at the ortho and meta positions, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms and the nitro group, which can influence its reactivity and solubility in different solvents. The difluoromethoxy group may enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple substituents can lead to specific interactions in biological systems, potentially affecting its biological activity. Safety and handling precautions should be observed, as nitro compounds can be hazardous and may require specific storage conditions.

Formula: C₉H₉F₂NO₃

InChI: InChI=1S/C9H9F2NO3/c1-5-3-4-7(12(13)14)6(2)8(5)15-9(10)11/h3-4,9H,1-2H3

InChI key: InChIKey=DFNJPYHEMTVTGT-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=C(C)C(N(=O)=O)=CC=C1C

Synonyms:

• Benzene, 2-(difluoromethoxy)-1,3-dimethyl-4-nitro-
• 2-(Difluoromethoxy)-1,3-dimethyl-4-nitrobenzene