CymitQuimica logo

CAS 10556-91-9

:

4,4,4-TRIFLUORO-2-PROPYL-3-OXOBUTYRIC ACID ETHYL ESTER

Description:
4,4,4-Trifluoro-2-propyl-3-oxobutyric acid ethyl ester, with the CAS number 10556-91-9, is an organic compound characterized by its trifluoromethyl group, which imparts unique properties such as increased lipophilicity and potential biological activity. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester moiety suggests that it may exhibit moderate volatility and solubility in organic solvents, making it useful in various chemical processes. Its trifluoromethyl group can enhance the compound's stability and influence its interaction with biological systems, potentially making it of interest in pharmaceutical research. Additionally, the structural arrangement indicates that it may participate in various chemical reactions, including esterification and nucleophilic attacks. Safety data should be consulted for handling, as fluorinated compounds can exhibit unique toxicological profiles. Overall, this compound represents a versatile building block in synthetic organic chemistry and may have applications in agrochemicals or pharmaceuticals.
Formula:C9H13F3O3
InChI:InChI=1/C9H13F3O3/c1-3-5-6(8(14)15-4-2)7(13)9(10,11)12/h6H,3-5H2,1-2H3
SMILES:CCCC(C(=O)C(F)(F)F)C(=O)OCC
Synonyms:
  • Ethyl 2-(trifluoroacetyl)pentanoate
  • Pentanoic Acid, 2-(2,2,2-Trifluoroacetyl)-, Ethyl Ester
  • Ethyl 2-(2,2,2-Trifluoroacetyl)Pentanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.