CAS 105560-93-8
:Methyl (2R,3S)-3-(4-methoxyphenyl)-2-oxiranecarboxylate
Description:
Methyl (2R,3S)-3-(4-methoxyphenyl)-2-oxiranecarboxylate, with the CAS number 105560-93-8, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a methoxy-substituted phenyl group, contributing to its aromatic properties and potentially influencing its reactivity and solubility. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as nucleophilic attacks or esterification. The stereochemistry denoted by (2R,3S) suggests specific spatial arrangements of its substituents, which can affect its biological activity and interaction with other molecules. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its structural features, which could lead to the development of novel pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of other functional groups in the molecule.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c1-13-8-5-3-7(4-6-8)9-10(15-9)11(12)14-2/h3-6,9-10H,1-2H3/t9-,10+/m0/s1
InChI key:InChIKey=CVZUMGUZDAWOGA-VHSXEESVSA-N
SMILES:C(OC)(=O)[C@H]1[C@@H](O1)C2=CC=C(OC)C=C2
Synonyms:- (-)-(2R,3S)-2,3-Epoxy-3-(4methoxyphenyl)propronate
- (2R,3S)-3-(4-Methoxyphenyl)glycidic acid methyl ester
- 2-Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, methyl ester, (2R,3S)-
- Methyl (-)-(2R,3S)-2,3-Epoxy-3-(4-Methoxyphenyl)Propionate
- Methyl (-)-(2R,3S)-2,3-Epoxy-3-(4Methoxyphenyl)Propronate
- Methyl (2R,3S)-3-(4-methoxyphenyl)-2-oxiranecarboxylate
- Methyl (2R,3S)-3-(4-methoxyphenyl)glycidate
- Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, methyl ester, (2R,3S)-
- Oxiranecarboxylic acid, 3-(4-methoxyphenyl)-, methyl ester, (2R-trans)-
- methyl (2R,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate
- methyl (2S,3S)-3-(4-methoxyphenyl)oxirane-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
