CAS 10557-13-8

1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione

Description:

1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione, with the CAS number 10557-13-8, is an organic compound characterized by its unique structure that includes a trifluoromethyl group attached to a phenyl ring and a diketone functional group. This compound typically exhibits properties associated with diketones, such as being a potential precursor in organic synthesis and exhibiting reactivity due to the presence of carbonyl groups. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it of interest in medicinal chemistry and materials science. The presence of fluorine atoms often imparts unique characteristics, such as increased stability and altered solubility compared to non-fluorinated analogs. Additionally, this compound may exhibit interesting photophysical properties, making it suitable for applications in dyes or sensors. Its synthesis and reactivity can be explored in various chemical reactions, including condensation and substitution reactions, which are common in the chemistry of diketones.

Formula: C₁₀H₇F₃O₂

InChI: InChI=1/C10H7F3O2/c1-6(14)9(15)7-2-4-8(5-3-7)10(11,12)13/h2-5H,1H3

SMILES: CC(=O)C(=O)c1ccc(cc1)C(F)(F)F

Synonyms:

• 1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione97%

1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione

CAS: 10557-13-8

Formula: C₁₀H₇F₃O₂

Molecular weight: 216.1566

Ref: IN-DA007W2T

1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione

CAS: 10557-13-8

1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione

Formula: C₁₀H₇F₃O₂

Purity: 95%

Color and Shape: yellow. clear fused solid

Molecular weight: 216.16g/mol

Ref: 54-PC4369

1-(4-Trifluoromethylphenyl)-1,2-propanedione

CAS: 10557-13-8

Formula: C₁₀H₇F₃O₂

Purity: 95.0%

Color and Shape: Clear

Molecular weight: 216.159

Ref: 10-F009382