CymitQuimica logo

CAS 10557-17-2

:

1,2-Propanedione, 1-(3-chlorophenyl)-

Description:
1,2-Propanedione, 1-(3-chlorophenyl)-, also known by its CAS number 10557-17-2, is an organic compound characterized by its diketone structure, featuring a propanedione backbone with a chlorophenyl substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its distinct aromatic odor. It is soluble in organic solvents and exhibits limited solubility in water. The presence of the chlorophenyl group enhances its reactivity, making it useful in various chemical synthesis applications, including the production of pharmaceuticals and agrochemicals. Additionally, 1,2-propanedione derivatives are often studied for their potential biological activities, including antimicrobial and anti-inflammatory properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound serves as an important intermediate in organic synthesis and has implications in both industrial and research settings.
Formula:C9H7ClO2
InChI:InChI=1S/C9H7ClO2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-5H,1H3
InChI key:OXRBHYVHVKOEQX-UHFFFAOYSA-N
SMILES:CC(=O)C(=O)C1=CC(=CC=C1)Cl
Found 10 products.