CAS 10557-73-0
:4-Bromo-5-phenylisoxazole
Description:
4-Bromo-5-phenylisoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a bromine atom at the 4-position and a phenyl group at the 5-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic phenyl group. It is often utilized in medicinal chemistry and research due to its potential biological activity, including anti-inflammatory and analgesic properties. The compound's reactivity can be influenced by the electron-withdrawing nature of the bromine atom, which can affect its interaction with nucleophiles. Additionally, 4-Bromo-5-phenylisoxazole can participate in various chemical reactions, such as electrophilic substitutions and nucleophilic additions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-8-6-11-12-9(8)7-4-2-1-3-5-7/h1-6H
InChI key:InChIKey=OPNQYKVNIGKUAF-UHFFFAOYSA-N
SMILES:BrC1=C(ON=C1)C2=CC=CC=C2
Synonyms:- 4-Bromo-5-phenylisoxazole
- Isoxazole, 4-bromo-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.