CymitQuimica logo

CAS 10557-82-1

:

3,4,5-Trimethylisoxazole

Description:
3,4,5-Trimethylisoxazole is a heterocyclic organic compound characterized by its five-membered ring structure containing both nitrogen and oxygen atoms. It features three methyl groups attached to the isoxazole ring, specifically at the 3, 4, and 5 positions, which contributes to its unique chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its stability under standard conditions and exhibits moderate solubility in polar organic solvents. 3,4,5-Trimethylisoxazole is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which can be explored in drug development. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C6H9NO
InChI:InChI=1S/C6H9NO/c1-4-5(2)7-8-6(4)3/h1-3H3
InChI key:InChIKey=MGHKWBQZEBMFOH-UHFFFAOYSA-N
SMILES:CC=1C(C)=NOC1C
Synonyms:
  • Isoxazole, 3,4,5-trimethyl-
  • 3,4,5-Trimethylisoxazole
  • Isoxazole, trimethyl-
  • Trimethylisoxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.