CAS 10558-25-5
:4-Bromo-3,5-dimethylisoxazole
Description:
4-Bromo-3,5-dimethylisoxazole is a heterocyclic organic compound characterized by its isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The presence of bromine at the 4-position and two methyl groups at the 3 and 5 positions contributes to its unique chemical properties. This compound is typically a pale yellow to light brown solid and is known for its moderate solubility in organic solvents. It exhibits interesting reactivity due to the electron-withdrawing nature of the bromine atom, which can influence its behavior in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. 4-Bromo-3,5-dimethylisoxazole is often utilized in synthetic organic chemistry and medicinal chemistry for the development of pharmaceuticals and agrochemicals. Its specific applications may vary, but it is generally valued for its potential biological activity and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H6BrNO
InChI:InChI=1/C5H6BrNO/c1-3-5(6)4(2)8-7-3/h1-2H3
SMILES:Cc1c(c(C)on1)Br
Synonyms:- Timtec-Bb Sbb003784
- Buttpark 33\06-98
- 3,5-Dimethyl-4-bromoisoxazole
- 4-Bromo-3,5-Dimethyl-1,2-Oxazole
- 4-Bromo-dimethylisoxazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-3,5-dimethylisoxazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H6BrNOPurity:97%Color and Shape:Clear colorless to yellow to brown, LiquidMolecular weight:176.014-BroMo-3,5-diMethylisoxazole
CAS:Formula:C5H6BrNOPurity:98%Color and Shape:LiquidMolecular weight:176.01124-Bromo-3,5-dimethylisoxazole
CAS:4-Bromo-3,5-dimethylisoxazoleFormula:C5H6BrNOPurity:≥95%Color and Shape: faint beige liquidMolecular weight:176.01g/mol4-Bromo-3,5-dimethylisoxazole
CAS:Formula:C5H6BrNOPurity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:176.014-Bromo-3,5-dimethylisoxazole
CAS:Formula:C5H6BrNOPurity:97%Color and Shape:LiquidMolecular weight:176.013




